C24H37N5O4 — CID 142618045
(E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;3-[(5-phenylpyrazol-1-yl)methyl]pentan-3-ol (PubChem CID 142618045) has the molecular formula C24H37N5O4 and a molecular weight of 459.59 g/mol. Its IUPAC name is (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;3-[(5-phenylpyrazol-1-yl)methyl]pentan-3-ol.
| Compound Name | (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;3-[(5-phenylpyrazol-1-yl)methyl]pentan-3-ol |
|---|---|
| PubChem CID | 142618045 |
| Molecular Formula | C24H37N5O4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;3-[(5-phenylpyrazol-1-yl)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)Cn1nccc1-c1ccccc1.NN/C(C(=O)O)=C(\N)OC1CCCCC1 |
| InChI | InChI=1S/C15H20N2O.C9H17N3O3/c1-3-15(18,4-2)12-17-14(10-11-16-17)13-8-6-5-7-9-13;10-8(7(12-11)9(13)14)15-6-4-2-1-3-5-6/h5-11,18H,3-4,12H2,1-2H3;6,12H,1-5,10-11H2,(H,13,14)/b;8-7+ |
| InChIKey | URRJBJYDGLUEQU-ILHSMLOTSA-N |
| XLogP | 3.11 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|