C21H31N5O3 — CID 142618531
(E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;3-phenyl-5-propan-2-yl-1H-pyrazole (PubChem CID 142618531) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;3-phenyl-5-propan-2-yl-1H-pyrazole.
| Compound Name | (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;3-phenyl-5-propan-2-yl-1H-pyrazole |
|---|---|
| PubChem CID | 142618531 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;3-phenyl-5-propan-2-yl-1H-pyrazole |
| SMILES | CC(C)c1cc(-c2ccccc2)n[nH]1.NN/C(C(=O)O)=C(\N)OC1CCCCC1 |
| InChI | InChI=1S/C12H14N2.C9H17N3O3/c1-9(2)11-8-12(14-13-11)10-6-4-3-5-7-10;10-8(7(12-11)9(13)14)15-6-4-2-1-3-5-6/h3-9H,1-2H3,(H,13,14);6,12H,1-5,10-11H2,(H,13,14)/b;8-7+ |
| InChIKey | ZBJVRXSSTJIIDW-ILHSMLOTSA-N |
| XLogP | 3.21 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|