C11H19N3O3 — CID 142618300
(E)-3-amino-2-hydrazinyl-3-spiro[2.5]octan-6-yloxyprop-2-enoic acid (PubChem CID 142618300) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is (E)-3-amino-2-hydrazinyl-3-spiro[2.5]octan-6-yloxyprop-2-enoic acid.
| Compound Name | (E)-3-amino-2-hydrazinyl-3-spiro[2.5]octan-6-yloxyprop-2-enoic acid |
|---|---|
| PubChem CID | 142618300 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | (E)-3-amino-2-hydrazinyl-3-spiro[2.5]octan-6-yloxyprop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)OC1CCC2(CC1)CC2 |
| InChI | InChI=1S/C11H19N3O3/c12-9(8(14-13)10(15)16)17-7-1-3-11(4-2-7)5-6-11/h7,14H,1-6,12-13H2,(H,15,16)/b9-8+ |
| InChIKey | SPEMTQSEDKNXDH-CMDGGOBGSA-N |
| XLogP | 0.40 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|