About spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate
spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate (PubChem CID 162724749) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate.
Molecular Properties
| Compound Name | spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate |
| PubChem CID | 162724749 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate |
| SMILES | CC(C)(N)C(=O)OC1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C14H25NO2/c1-13(2,15)12(16)17-11-5-9-14(10-6-11)7-3-4-8-14/h11H,3-10,15H2,1-2H3 |
| InChIKey | YXJUQBISUYVQNE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate?
The IUPAC name of spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate (CID 162724749) is spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate.
What is the SMILES notation for spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate?
The canonical SMILES for spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate is CC(C)(N)C(=O)OC1CCC2(CCCC2)CC1.
What is the InChIKey of spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate?
The InChIKey is YXJUQBISUYVQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-13(2,15)12(16)17-11-5-9-14(10-6-11)7-3-4-8-14/h11H,3-10,15H2,1-2H3.
What are the key properties of spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate?
spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate has a molecular weight of 239.36 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.5]decan-8-yl 2-amino-2-methylpropanoate is sourced from PubChem (CID 162724749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).