About (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate
(4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate (PubChem CID 114341563) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate.
Analyze (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate?
The IUPAC name of (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate (CID 114341563) is (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate.
What is the SMILES notation for (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate?
The canonical SMILES for (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate is CNC(C)(C)C(=O)OC1CCC(C)(C)CC1.
What is the InChIKey of (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate?
The InChIKey is GESCDJRFOGIOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-12(2)8-6-10(7-9-12)16-11(15)13(3,4)14-5/h10,14H,6-9H2,1-5H3.
What are the key properties of (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate?
(4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate has a molecular weight of 227.35 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethylcyclohexyl) 2-methyl-2-(methylamino)propanoate is sourced from PubChem (CID 114341563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).