C12H19NO3 — CID 102379544
(4-cyano-4-hydroxycyclohexyl) 2,2-dimethylpropanoate (PubChem CID 102379544) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (4-cyano-4-hydroxycyclohexyl) 2,2-dimethylpropanoate.
| Compound Name | (4-cyano-4-hydroxycyclohexyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102379544 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (4-cyano-4-hydroxycyclohexyl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1CCC(O)(C#N)CC1 |
| InChI | InChI=1S/C12H19NO3/c1-11(2,3)10(14)16-9-4-6-12(15,8-13)7-5-9/h9,15H,4-7H2,1-3H3 |
| InChIKey | OAQUDHPHRZUAAO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|