About (4-cyanocyclohexyl) 2,2-dimethylbutanoate
(4-cyanocyclohexyl) 2,2-dimethylbutanoate (PubChem CID 58030563) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is (4-cyanocyclohexyl) 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | (4-cyanocyclohexyl) 2,2-dimethylbutanoate |
| PubChem CID | 58030563 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (4-cyanocyclohexyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCC(C#N)CC1 |
| InChI | InChI=1S/C13H21NO2/c1-4-13(2,3)12(15)16-11-7-5-10(9-14)6-8-11/h10-11H,4-8H2,1-3H3 |
| InChIKey | MGYPWGDBEQDGFO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-cyanocyclohexyl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanocyclohexyl) 2,2-dimethylbutanoate?
The IUPAC name of (4-cyanocyclohexyl) 2,2-dimethylbutanoate (CID 58030563) is (4-cyanocyclohexyl) 2,2-dimethylbutanoate.
What is the SMILES notation for (4-cyanocyclohexyl) 2,2-dimethylbutanoate?
The canonical SMILES for (4-cyanocyclohexyl) 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1CCC(C#N)CC1.
What is the InChIKey of (4-cyanocyclohexyl) 2,2-dimethylbutanoate?
The InChIKey is MGYPWGDBEQDGFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-4-13(2,3)12(15)16-11-7-5-10(9-14)6-8-11/h10-11H,4-8H2,1-3H3.
What are the key properties of (4-cyanocyclohexyl) 2,2-dimethylbutanoate?
(4-cyanocyclohexyl) 2,2-dimethylbutanoate has a molecular weight of 223.32 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanocyclohexyl) 2,2-dimethylbutanoate is sourced from PubChem (CID 58030563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).