C14H27NO4S — CID 118346143
[4-(ethylsulfonylamino)cyclohexyl] 2,2-dimethylbutanoate (PubChem CID 118346143) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is [4-(ethylsulfonylamino)cyclohexyl] 2,2-dimethylbutanoate.
| Compound Name | [4-(ethylsulfonylamino)cyclohexyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118346143 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | [4-(ethylsulfonylamino)cyclohexyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCC(NS(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C14H27NO4S/c1-5-14(3,4)13(16)19-12-9-7-11(8-10-12)15-20(17,18)6-2/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | JPCOFSJWDKUFNQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |