C9H16F3NO2S — CID 61356177
N-[4-(trifluoromethyl)cyclohexyl]ethanesulfonamide (PubChem CID 61356177) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)cyclohexyl]ethanesulfonamide.
| Compound Name | N-[4-(trifluoromethyl)cyclohexyl]ethanesulfonamide |
|---|---|
| PubChem CID | 61356177 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-[4-(trifluoromethyl)cyclohexyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H16F3NO2S/c1-2-16(14,15)13-8-5-3-7(4-6-8)9(10,11)12/h7-8,13H,2-6H2,1H3 |
| InChIKey | LDWLSYXZSRDXTJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |