About cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde
cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde (PubChem CID 23291684) has the molecular formula C18H30N2O2
and a molecular weight of 306.45 g/mol. Its IUPAC name is cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde.
Molecular Properties
| Compound Name | cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde |
| PubChem CID | 23291684 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde |
| SMILES | CN(C)CCCOc1ccc(C=O)cc1.NC1CCCCC1 |
| InChI | InChI=1S/C12H17NO2.C6H13N/c1-13(2)8-3-9-15-12-6-4-11(10-14)5-7-12;7-6-4-2-1-3-5-6/h4-7,10H,3,8-9H2,1-2H3;6H,1-5,7H2 |
| InChIKey | FKOBNYKBKTUADD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde?
The IUPAC name of cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde (CID 23291684) is cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde.
What is the SMILES notation for cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde?
The canonical SMILES for cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde is CN(C)CCCOc1ccc(C=O)cc1.NC1CCCCC1.
What is the InChIKey of cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde?
The InChIKey is FKOBNYKBKTUADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.C6H13N/c1-13(2)8-3-9-15-12-6-4-11(10-14)5-7-12;7-6-4-2-1-3-5-6/h4-7,10H,3,8-9H2,1-2H3;6H,1-5,7H2.
What are the key properties of cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde?
cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde has a molecular weight of 306.45 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;4-[3-(dimethylamino)propoxy]benzaldehyde is sourced from PubChem (CID 23291684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).