About 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde
4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde (PubChem CID 158129131) has the molecular formula C18H22N2O3
and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde.
Molecular Properties
| Compound Name | 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde |
| PubChem CID | 158129131 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde |
| SMILES | CN(C)CCCOc1ccc(C=O)cc1.O=Cc1ccncc1 |
| InChI | InChI=1S/C12H17NO2.C6H5NO/c1-13(2)8-3-9-15-12-6-4-11(10-14)5-7-12;8-5-6-1-3-7-4-2-6/h4-7,10H,3,8-9H2,1-2H3;1-5H |
| InChIKey | FSOAYWANTOTNCA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde?
The IUPAC name of 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde (CID 158129131) is 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde.
What is the SMILES notation for 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde?
The canonical SMILES for 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde is CN(C)CCCOc1ccc(C=O)cc1.O=Cc1ccncc1.
What is the InChIKey of 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde?
The InChIKey is FSOAYWANTOTNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.C6H5NO/c1-13(2)8-3-9-15-12-6-4-11(10-14)5-7-12;8-5-6-1-3-7-4-2-6/h4-7,10H,3,8-9H2,1-2H3;1-5H.
What are the key properties of 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde?
4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde has a molecular weight of 314.39 g/mol, XLogP of 2.72, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(dimethylamino)propoxy]benzaldehyde;pyridine-4-carbaldehyde is sourced from PubChem (CID 158129131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).