C13H15Cl2N3O3 — CID 142618173
(E)-3-amino-3-[(6,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-2-hydrazinylprop-2-enoic acid (PubChem CID 142618173) has the molecular formula C13H15Cl2N3O3 and a molecular weight of 332.19 g/mol. Its IUPAC name is (E)-3-amino-3-[(6,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-2-hydrazinylprop-2-enoic acid.
| Compound Name | (E)-3-amino-3-[(6,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-2-hydrazinylprop-2-enoic acid |
|---|---|
| PubChem CID | 142618173 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (E)-3-amino-3-[(6,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-2-hydrazinylprop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)OC1CCc2cc(Cl)c(Cl)cc2C1 |
| InChI | InChI=1S/C13H15Cl2N3O3/c14-9-4-6-1-2-8(3-7(6)5-10(9)15)21-12(16)11(18-17)13(19)20/h4-5,8,18H,1-3,16-17H2,(H,19,20)/b12-11+ |
| InChIKey | ZTUVWLOSNJJIJV-VAWYXSNFSA-N |
| XLogP | 1.54 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|