C17H17Cl2N3O5 — CID 142618809
propanoyloxymethyl 4-[(6,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-1H-triazole-5-carboxylate (PubChem CID 142618809) has the molecular formula C17H17Cl2N3O5 and a molecular weight of 414.25 g/mol. Its IUPAC name is propanoyloxymethyl 4-[(6,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-1H-triazole-5-carboxylate.
| Compound Name | propanoyloxymethyl 4-[(6,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-1H-triazole-5-carboxylate |
|---|---|
| PubChem CID | 142618809 |
| Molecular Formula | C17H17Cl2N3O5 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | propanoyloxymethyl 4-[(6,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-1H-triazole-5-carboxylate |
| SMILES | CCC(=O)OCOC(=O)c1[nH]nnc1OC1CCc2cc(Cl)c(Cl)cc2C1 |
| InChI | InChI=1S/C17H17Cl2N3O5/c1-2-14(23)25-8-26-17(24)15-16(21-22-20-15)27-11-4-3-9-6-12(18)13(19)7-10(9)5-11/h6-7,11H,2-5,8H2,1H3,(H,20,21,22) |
| InChIKey | LBRMXQZAOXXBIU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|