C22H27F3N4O6 — CID 142617695
diethylcarbamoyloxymethyl 4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylate (PubChem CID 142617695) has the molecular formula C22H27F3N4O6 and a molecular weight of 500.47 g/mol. Its IUPAC name is diethylcarbamoyloxymethyl 4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylate.
| Compound Name | diethylcarbamoyloxymethyl 4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylate |
|---|---|
| PubChem CID | 142617695 |
| Molecular Formula | C22H27F3N4O6 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | diethylcarbamoyloxymethyl 4-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylate |
| SMILES | CCN(CC)C(=O)OCOC(=O)c1[nH]nnc1OC1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H27F3N4O6/c1-3-29(4-2)21(31)33-13-32-20(30)18-19(27-28-26-18)34-16-9-5-14(6-10-16)15-7-11-17(12-8-15)35-22(23,24)25/h7-8,11-12,14,16H,3-6,9-10,13H2,1-2H3,(H,26,27,28) |
| InChIKey | HZLVKYRPGXLNGB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|