C17H19Cl2N3O3 — CID 155422828
ethyl 4-[4-(3,5-dichlorophenyl)cyclohexyl]oxy-1H-triazole-5-carboxylate (PubChem CID 155422828) has the molecular formula C17H19Cl2N3O3 and a molecular weight of 384.26 g/mol. Its IUPAC name is ethyl 4-[4-(3,5-dichlorophenyl)cyclohexyl]oxy-1H-triazole-5-carboxylate.
| Compound Name | ethyl 4-[4-(3,5-dichlorophenyl)cyclohexyl]oxy-1H-triazole-5-carboxylate |
|---|---|
| PubChem CID | 155422828 |
| Molecular Formula | C17H19Cl2N3O3 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | ethyl 4-[4-(3,5-dichlorophenyl)cyclohexyl]oxy-1H-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]nnc1OC1CCC(c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H19Cl2N3O3/c1-2-24-17(23)15-16(21-22-20-15)25-14-5-3-10(4-6-14)11-7-12(18)9-13(19)8-11/h7-10,14H,2-6H2,1H3,(H,20,21,22) |
| InChIKey | VEGAQCMMJFQEFM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |