C25H25ClN2O3 — CID 70296527
ethyl 3-[4-(3-chlorophenyl)cyclohexyl]oxy-6-phenylpyridazine-4-carboxylate (PubChem CID 70296527) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is ethyl 3-[4-(3-chlorophenyl)cyclohexyl]oxy-6-phenylpyridazine-4-carboxylate.
| Compound Name | ethyl 3-[4-(3-chlorophenyl)cyclohexyl]oxy-6-phenylpyridazine-4-carboxylate |
|---|---|
| PubChem CID | 70296527 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | ethyl 3-[4-(3-chlorophenyl)cyclohexyl]oxy-6-phenylpyridazine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)nnc1OC1CCC(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H25ClN2O3/c1-2-30-25(29)22-16-23(18-7-4-3-5-8-18)27-28-24(22)31-21-13-11-17(12-14-21)19-9-6-10-20(26)15-19/h3-10,15-17,21H,2,11-14H2,1H3 |
| InChIKey | GHLDJKIHYKRDQK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |