C16H17NO2 — CID 102028571
ethyl 2-cyclopropyl-5-phenyl-1H-pyrrole-3-carboxylate (PubChem CID 102028571) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl 2-cyclopropyl-5-phenyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2-cyclopropyl-5-phenyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102028571 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethyl 2-cyclopropyl-5-phenyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)[nH]c1C1CC1 |
| InChI | InChI=1S/C16H17NO2/c1-2-19-16(18)13-10-14(11-6-4-3-5-7-11)17-15(13)12-8-9-12/h3-7,10,12,17H,2,8-9H2,1H3 |
| InChIKey | FPCCVAVDBACKTK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |