C15H19N3O2 — CID 82365141
ethyl 2-amino-5-[4-(dimethylamino)phenyl]-1H-pyrrole-3-carboxylate (PubChem CID 82365141) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is ethyl 2-amino-5-[4-(dimethylamino)phenyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2-amino-5-[4-(dimethylamino)phenyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 82365141 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | ethyl 2-amino-5-[4-(dimethylamino)phenyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(N(C)C)cc2)[nH]c1N |
| InChI | InChI=1S/C15H19N3O2/c1-4-20-15(19)12-9-13(17-14(12)16)10-5-7-11(8-6-10)18(2)3/h5-9,17H,4,16H2,1-3H3 |
| InChIKey | UFRLYVFNCHYQLY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|