C24H28F3N3O6 — CID 175057901
cyclohexanecarbonyl 3-methyl-5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxytriazole-4-carboperoxoate (PubChem CID 175057901) has the molecular formula C24H28F3N3O6 and a molecular weight of 511.50 g/mol. Its IUPAC name is cyclohexanecarbonyl 3-methyl-5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxytriazole-4-carboperoxoate.
| Compound Name | cyclohexanecarbonyl 3-methyl-5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxytriazole-4-carboperoxoate |
|---|---|
| PubChem CID | 175057901 |
| Molecular Formula | C24H28F3N3O6 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | cyclohexanecarbonyl 3-methyl-5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxytriazole-4-carboperoxoate |
| SMILES | Cn1nnc(OC2CCC(c3ccc(OC(F)(F)F)cc3)CC2)c1C(=O)OOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C24H28F3N3O6/c1-30-20(23(32)36-35-22(31)17-5-3-2-4-6-17)21(28-29-30)33-18-11-7-15(8-12-18)16-9-13-19(14-10-16)34-24(25,26)27/h9-10,13-15,17-18H,2-8,11-12H2,1H3 |
| InChIKey | AMEOVDRRWPOJMU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 101.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|