C25H31F3N2O2 — CID 142308079
(Z)-3-cyclopropyl-2-(1H-imidazol-5-yl)-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]but-2-en-1-one;ethane (PubChem CID 142308079) has the molecular formula C25H31F3N2O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is (Z)-3-cyclopropyl-2-(1H-imidazol-5-yl)-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]but-2-en-1-one;ethane.
| Compound Name | (Z)-3-cyclopropyl-2-(1H-imidazol-5-yl)-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]but-2-en-1-one;ethane |
|---|---|
| PubChem CID | 142308079 |
| Molecular Formula | C25H31F3N2O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (Z)-3-cyclopropyl-2-(1H-imidazol-5-yl)-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]but-2-en-1-one;ethane |
| SMILES | C/C(=C(/C(=O)C1CCC(c2ccc(OC(F)(F)F)cc2)CC1)c1cnc[nH]1)C1CC1.CC |
| InChI | InChI=1S/C23H25F3N2O2.C2H6/c1-14(15-2-3-15)21(20-12-27-13-28-20)22(29)18-6-4-16(5-7-18)17-8-10-19(11-9-17)30-23(24,25)26;1-2/h8-13,15-16,18H,2-7H2,1H3,(H,27,28);1-2H3/b21-14-; |
| InChIKey | ZVZAKMBZJYHLQX-UXTSPRGOSA-N |
| XLogP | 7.06 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|