C16H17F3N4O3 — CID 155250183
5-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]amino]-2H-triazole-4-carboxylic acid (PubChem CID 155250183) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is 5-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]amino]-2H-triazole-4-carboxylic acid.
| Compound Name | 5-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]amino]-2H-triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155250183 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]amino]-2H-triazole-4-carboxylic acid |
| SMILES | O=C(O)c1n[nH]nc1NC1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H17F3N4O3/c17-16(18,19)26-12-7-3-10(4-8-12)9-1-5-11(6-2-9)20-14-13(15(24)25)21-23-22-14/h3-4,7-9,11H,1-2,5-6H2,(H,24,25)(H2,20,21,22,23) |
| InChIKey | ONELHRPVFLIXRT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |