C21H18F3N3O5S — CID 175062144
2-methylpropanoyl 3-methyl-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanyltriazole-4-carboperoxoate (PubChem CID 175062144) has the molecular formula C21H18F3N3O5S and a molecular weight of 481.45 g/mol. Its IUPAC name is 2-methylpropanoyl 3-methyl-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanyltriazole-4-carboperoxoate.
| Compound Name | 2-methylpropanoyl 3-methyl-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanyltriazole-4-carboperoxoate |
|---|---|
| PubChem CID | 175062144 |
| Molecular Formula | C21H18F3N3O5S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-methylpropanoyl 3-methyl-5-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanyltriazole-4-carboperoxoate |
| SMILES | CC(C)C(=O)OOC(=O)c1c(Sc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)nnn1C |
| InChI | InChI=1S/C21H18F3N3O5S/c1-12(2)19(28)31-32-20(29)17-18(25-26-27(17)3)33-16-10-6-14(7-11-16)13-4-8-15(9-5-13)30-21(22,23)24/h4-12H,1-3H3 |
| InChIKey | LOJQIZABPHUBLZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|