C36H25F3N2O3S — CID 161163688
5-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanyl-3-tritylimidazole-4-carboxylic acid (PubChem CID 161163688) has the molecular formula C36H25F3N2O3S and a molecular weight of 622.67 g/mol. Its IUPAC name is 5-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanyl-3-tritylimidazole-4-carboxylic acid.
| Compound Name | 5-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanyl-3-tritylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 161163688 |
| Molecular Formula | C36H25F3N2O3S |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | 5-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanyl-3-tritylimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1c(Sc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)ncn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H25F3N2O3S/c37-36(38,39)44-30-20-16-25(17-21-30)26-18-22-31(23-19-26)45-33-32(34(42)43)41(24-40-33)35(27-10-4-1-5-11-27,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-24H,(H,42,43) |
| InChIKey | SSGFKDGJTQSERM-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|