C11H6F3NO3S — CID 106510431
5-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 106510431) has the molecular formula C11H6F3NO3S and a molecular weight of 289.23 g/mol. Its IUPAC name is 5-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106510431 |
| Molecular Formula | C11H6F3NO3S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 5-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H6F3NO3S/c12-11(13,14)18-7-3-1-6(2-4-7)9-8(10(16)17)15-5-19-9/h1-5H,(H,16,17) |
| InChIKey | VUFZKRWJEVDRFC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |