C11H7F3N2O3S — CID 64630070
5-[4-(trifluoromethoxy)anilino]-1,3-thiazole-4-carboxylic acid (PubChem CID 64630070) has the molecular formula C11H7F3N2O3S and a molecular weight of 304.25 g/mol. Its IUPAC name is 5-[4-(trifluoromethoxy)anilino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[4-(trifluoromethoxy)anilino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 64630070 |
| Molecular Formula | C11H7F3N2O3S |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 5-[4-(trifluoromethoxy)anilino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7F3N2O3S/c12-11(13,14)19-7-3-1-6(2-4-7)16-9-8(10(17)18)15-5-20-9/h1-5,16H,(H,17,18) |
| InChIKey | VJVAYWJFEDUSMB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |