C10H6F2N2O2S — CID 64631095
5-(3,4-difluoroanilino)-1,3-thiazole-4-carboxylic acid (PubChem CID 64631095) has the molecular formula C10H6F2N2O2S and a molecular weight of 256.23 g/mol. Its IUPAC name is 5-(3,4-difluoroanilino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(3,4-difluoroanilino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 64631095 |
| Molecular Formula | C10H6F2N2O2S |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 5-(3,4-difluoroanilino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H6F2N2O2S/c11-6-2-1-5(3-7(6)12)14-9-8(10(15)16)13-4-17-9/h1-4,14H,(H,15,16) |
| InChIKey | MXMZMEDVMSTGRZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |