C22H24F3N3O5S — CID 142617988
(E)-3-amino-2-[amino(2,2-dimethylpropanoyloxymethyl)amino]-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanylprop-2-enoic acid (PubChem CID 142617988) has the molecular formula C22H24F3N3O5S and a molecular weight of 499.51 g/mol. Its IUPAC name is (E)-3-amino-2-[amino(2,2-dimethylpropanoyloxymethyl)amino]-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-amino-2-[amino(2,2-dimethylpropanoyloxymethyl)amino]-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 142617988 |
| Molecular Formula | C22H24F3N3O5S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (E)-3-amino-2-[amino(2,2-dimethylpropanoyloxymethyl)amino]-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanylprop-2-enoic acid |
| SMILES | CC(C)(C)C(=O)OCN(N)/C(C(=O)O)=C(\N)Sc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H24F3N3O5S/c1-21(2,3)20(31)32-12-28(27)17(19(29)30)18(26)34-16-10-6-14(7-11-16)13-4-8-15(9-5-13)33-22(23,24)25/h4-11H,12,26-27H2,1-3H3,(H,29,30)/b18-17+ |
| InChIKey | NFNFVPOLNFRPOF-ISLYRVAYSA-N |
| XLogP | 4.28 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|