C44H44F3N3O6 — CID 162250151
1-(cyclohexanecarbonyloxy)ethyl 5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-3-trityltriazole-4-carboxylate (PubChem CID 162250151) has the molecular formula C44H44F3N3O6 and a molecular weight of 767.85 g/mol. Its IUPAC name is 1-(cyclohexanecarbonyloxy)ethyl 5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-3-trityltriazole-4-carboxylate.
| Compound Name | 1-(cyclohexanecarbonyloxy)ethyl 5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-3-trityltriazole-4-carboxylate |
|---|---|
| PubChem CID | 162250151 |
| Molecular Formula | C44H44F3N3O6 |
| Molecular Weight | 767.85 g/mol |
| Exact Mass | 767.32 |
| IUPAC Name | 1-(cyclohexanecarbonyloxy)ethyl 5-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-3-trityltriazole-4-carboxylate |
| SMILES | CC(OC(=O)c1c(OC2CCC(c3ccc(OC(F)(F)F)cc3)CC2)nnn1C(c1ccccc1)(c1ccccc1)c1ccccc1)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C44H44F3N3O6/c1-30(53-41(51)33-14-6-2-7-15-33)54-42(52)39-40(55-37-26-22-31(23-27-37)32-24-28-38(29-25-32)56-44(45,46)47)48-49-50(39)43(34-16-8-3-9-17-34,35-18-10-4-11-19-35)36-20-12-5-13-21-36/h3-5,8-13,16-21,24-25,28-31,33,37H,2,6-7,14-15,22-23,26-27H2,1H3 |
| InChIKey | WXLRKDUJBQJMNK-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 101.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.85 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|