C29H28F3NO4 — CID 23508825
4-[2-(4-cyclohexylphenyl)-3-oxo-3-[4-(trifluoromethoxy)anilino]propyl]benzoic acid (PubChem CID 23508825) has the molecular formula C29H28F3NO4 and a molecular weight of 511.54 g/mol. Its IUPAC name is 4-[2-(4-cyclohexylphenyl)-3-oxo-3-[4-(trifluoromethoxy)anilino]propyl]benzoic acid.
| Compound Name | 4-[2-(4-cyclohexylphenyl)-3-oxo-3-[4-(trifluoromethoxy)anilino]propyl]benzoic acid |
|---|---|
| PubChem CID | 23508825 |
| Molecular Formula | C29H28F3NO4 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 4-[2-(4-cyclohexylphenyl)-3-oxo-3-[4-(trifluoromethoxy)anilino]propyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C29H28F3NO4/c30-29(31,32)37-25-16-14-24(15-17-25)33-27(34)26(18-19-6-8-23(9-7-19)28(35)36)22-12-10-21(11-13-22)20-4-2-1-3-5-20/h6-17,20,26H,1-5,18H2,(H,33,34)(H,35,36) |
| InChIKey | OTDRMAHWPCGVBL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |