C28H28F3NO3 — CID 67485718
4-[(4-cyclohexylphenyl)methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]benzoic acid (PubChem CID 67485718) has the molecular formula C28H28F3NO3 and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]benzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 67485718 |
| Molecular Formula | C28H28F3NO3 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(OC(F)(F)F)cc2)Cc2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H28F3NO3/c29-28(30,31)35-26-16-8-21(9-17-26)19-32(25-14-12-24(13-15-25)27(33)34)18-20-6-10-23(11-7-20)22-4-2-1-3-5-22/h6-17,22H,1-5,18-19H2,(H,33,34) |
| InChIKey | RRKJXEBGEXAGRD-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |