C22H29F3N4O6 — CID 155250375
4-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 155250375) has the molecular formula C22H29F3N4O6 and a molecular weight of 502.49 g/mol. Its IUPAC name is 4-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155250375 |
| Molecular Formula | C22H29F3N4O6 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 4-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCCOc1ccc(C2CCC(Oc3nn[nH]c3C(=O)O)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N4O4.C2HF3O2/c1-24(2)12-3-13-27-16-8-4-14(5-9-16)15-6-10-17(11-7-15)28-19-18(20(25)26)21-23-22-19;3-2(4,5)1(6)7/h4-5,8-9,15,17H,3,6-7,10-13H2,1-2H3,(H,25,26)(H,21,22,23);(H,6,7) |
| InChIKey | PODNBUDSAQUFBY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|