C22H28F3N5O5 — CID 155250694
4-[4-[4-(4-methylpiperazin-1-yl)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 155250694) has the molecular formula C22H28F3N5O5 and a molecular weight of 499.49 g/mol. Its IUPAC name is 4-[4-[4-(4-methylpiperazin-1-yl)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[4-(4-methylpiperazin-1-yl)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155250694 |
| Molecular Formula | C22H28F3N5O5 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 4-[4-[4-(4-methylpiperazin-1-yl)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(c2ccc(C3CCC(Oc4nn[nH]c4C(=O)O)CC3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N5O3.C2HF3O2/c1-24-10-12-25(13-11-24)16-6-2-14(3-7-16)15-4-8-17(9-5-15)28-19-18(20(26)27)21-23-22-19;3-2(4,5)1(6)7/h2-3,6-7,15,17H,4-5,8-13H2,1H3,(H,26,27)(H,21,22,23);(H,6,7) |
| InChIKey | AEUGGDANSDXHQH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|