C16H14ClF3N4O4 — CID 155250666
(2,2,2-trifluoroacetyl) 4-[1-(4-chlorophenyl)piperidin-4-yl]oxy-1H-triazole-5-carboxylate (PubChem CID 155250666) has the molecular formula C16H14ClF3N4O4 and a molecular weight of 418.76 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[1-(4-chlorophenyl)piperidin-4-yl]oxy-1H-triazole-5-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[1-(4-chlorophenyl)piperidin-4-yl]oxy-1H-triazole-5-carboxylate |
|---|---|
| PubChem CID | 155250666 |
| Molecular Formula | C16H14ClF3N4O4 |
| Molecular Weight | 418.76 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[1-(4-chlorophenyl)piperidin-4-yl]oxy-1H-triazole-5-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1[nH]nnc1OC1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H14ClF3N4O4/c17-9-1-3-10(4-2-9)24-7-5-11(6-8-24)27-13-12(21-23-22-13)14(25)28-15(26)16(18,19)20/h1-4,11H,5-8H2,(H,21,22,23) |
| InChIKey | KSXKFNREAOVDLM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|