C24H23ClF3N5O3 — CID 155250393
(2,2,2-trifluoroacetyl) 5-[[benzyl-[1-(4-chlorophenyl)piperidin-4-yl]amino]methyl]-2H-triazole-4-carboxylate (PubChem CID 155250393) has the molecular formula C24H23ClF3N5O3 and a molecular weight of 521.93 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 5-[[benzyl-[1-(4-chlorophenyl)piperidin-4-yl]amino]methyl]-2H-triazole-4-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 5-[[benzyl-[1-(4-chlorophenyl)piperidin-4-yl]amino]methyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 155250393 |
| Molecular Formula | C24H23ClF3N5O3 |
| Molecular Weight | 521.93 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 5-[[benzyl-[1-(4-chlorophenyl)piperidin-4-yl]amino]methyl]-2H-triazole-4-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1n[nH]nc1CN(Cc1ccccc1)C1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H23ClF3N5O3/c25-17-6-8-18(9-7-17)32-12-10-19(11-13-32)33(14-16-4-2-1-3-5-16)15-20-21(30-31-29-20)22(34)36-23(35)24(26,27)28/h1-9,19H,10-15H2,(H,29,30,31) |
| InChIKey | XCOXBJLBDQTLFV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.93 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|