C17H14F3NO3 — CID 175296578
[6-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1H-inden-1-yl] carbamate (PubChem CID 175296578) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is [6-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1H-inden-1-yl] carbamate.
| Compound Name | [6-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1H-inden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296578 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [6-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1H-inden-1-yl] carbamate |
| SMILES | NC(=O)OC1CCc2ccc(-c3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C17H14F3NO3/c18-17(19,20)24-13-6-3-10(4-7-13)12-2-1-11-5-8-15(14(11)9-12)23-16(21)22/h1-4,6-7,9,15H,5,8H2,(H2,21,22) |
| InChIKey | QOIXWNRRLLYCDO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |