C17H16ClNO2 — CID 175568823
[7-(4-chlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate (PubChem CID 175568823) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is [7-(4-chlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate.
| Compound Name | [7-(4-chlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate |
|---|---|
| PubChem CID | 175568823 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [7-(4-chlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate |
| SMILES | NC(=O)OC1CCCc2ccc(-c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C17H16ClNO2/c18-14-8-6-11(7-9-14)13-5-4-12-2-1-3-16(15(12)10-13)21-17(19)20/h4-10,16H,1-3H2,(H2,19,20) |
| InChIKey | RRLUIPIBHPZZJW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |