C20H23NO4 — CID 175568722
[6-[2-(2-methoxyethoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate (PubChem CID 175568722) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [6-[2-(2-methoxyethoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate.
| Compound Name | [6-[2-(2-methoxyethoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate |
|---|---|
| PubChem CID | 175568722 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [6-[2-(2-methoxyethoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate |
| SMILES | COCCOc1ccccc1-c1ccc2c(c1)CCCC2OC(N)=O |
| InChI | InChI=1S/C20H23NO4/c1-23-11-12-24-18-7-3-2-6-16(18)15-9-10-17-14(13-15)5-4-8-19(17)25-20(21)22/h2-3,6-7,9-10,13,19H,4-5,8,11-12H2,1H3,(H2,21,22) |
| InChIKey | CSGKKUYOZDCKIJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|