C18H19NO3 — CID 175568925
[6-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate (PubChem CID 175568925) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is [6-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate.
| Compound Name | [6-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate |
|---|---|
| PubChem CID | 175568925 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [6-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate |
| SMILES | COc1cccc(-c2ccc3c(c2)CCCC3OC(N)=O)c1 |
| InChI | InChI=1S/C18H19NO3/c1-21-15-6-2-4-12(11-15)13-8-9-16-14(10-13)5-3-7-17(16)22-18(19)20/h2,4,6,8-11,17H,3,5,7H2,1H3,(H2,19,20) |
| InChIKey | OPRIBZULXZYSNS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |