C17H18O2 — CID 129391570
(1S)-6-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 129391570) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1S)-6-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S)-6-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 129391570 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1S)-6-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | COc1cccc(-c2ccc3c(c2)CCC[C@@H]3O)c1 |
| InChI | InChI=1S/C17H18O2/c1-19-15-6-2-4-12(11-15)13-8-9-16-14(10-13)5-3-7-17(16)18/h2,4,6,8-11,17-18H,3,5,7H2,1H3/t17-/m0/s1 |
| InChIKey | RLRJQQXNBNDOQR-KRWDZBQOSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |