C15H15NO — CID 169410365
6-pyridin-3-yl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 169410365) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 6-pyridin-3-yl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 6-pyridin-3-yl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 169410365 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 6-pyridin-3-yl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OC1CCCc2cc(-c3cccnc3)ccc21 |
| InChI | InChI=1S/C15H15NO/c17-15-5-1-3-12-9-11(6-7-14(12)15)13-4-2-8-16-10-13/h2,4,6-10,15,17H,1,3,5H2 |
| InChIKey | IQNQJNGYEQHZOR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |