C16H16OS — CID 59021705
(1R)-6-phenylsulfanyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 59021705) has the molecular formula C16H16OS and a molecular weight of 256.37 g/mol. Its IUPAC name is (1R)-6-phenylsulfanyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R)-6-phenylsulfanyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 59021705 |
| Molecular Formula | C16H16OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (1R)-6-phenylsulfanyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | O[C@@H]1CCCc2cc(Sc3ccccc3)ccc21 |
| InChI | InChI=1S/C16H16OS/c17-16-8-4-5-12-11-14(9-10-15(12)16)18-13-6-2-1-3-7-13/h1-3,6-7,9-11,16-17H,4-5,8H2/t16-/m1/s1 |
| InChIKey | DUOKIPYRICOTEZ-MRXNPFEDSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |