C15H16N2O — CID 137476884
[(1S)-6-pyridin-3-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine (PubChem CID 137476884) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is [(1S)-6-pyridin-3-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine.
| Compound Name | [(1S)-6-pyridin-3-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine |
|---|---|
| PubChem CID | 137476884 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | [(1S)-6-pyridin-3-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine |
| SMILES | NC[C@H]1OCCc2cc(-c3cccnc3)ccc21 |
| InChI | InChI=1S/C15H16N2O/c16-9-15-14-4-3-11(8-12(14)5-7-18-15)13-2-1-6-17-10-13/h1-4,6,8,10,15H,5,7,9,16H2/t15-/m1/s1 |
| InChIKey | NRIOXHHWGSGFBW-OAHLLOKOSA-N |
| XLogP | 2.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |