C10H12BrNO — CID 130978437
(5-bromo-3,4-dihydro-1H-isochromen-1-yl)methanamine (PubChem CID 130978437) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is (5-bromo-3,4-dihydro-1H-isochromen-1-yl)methanamine.
| Compound Name | (5-bromo-3,4-dihydro-1H-isochromen-1-yl)methanamine |
|---|---|
| PubChem CID | 130978437 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | (5-bromo-3,4-dihydro-1H-isochromen-1-yl)methanamine |
| SMILES | NCC1OCCc2c(Br)cccc21 |
| InChI | InChI=1S/C10H12BrNO/c11-9-3-1-2-8-7(9)4-5-13-10(8)6-12/h1-3,10H,4-6,12H2 |
| InChIKey | GQNWRTDLCKPTGY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |