C17H18O2 — CID 155221844
1-methoxy-5-(4-methoxyphenyl)-2,3-dihydro-1H-indene (PubChem CID 155221844) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-methoxy-5-(4-methoxyphenyl)-2,3-dihydro-1H-indene.
| Compound Name | 1-methoxy-5-(4-methoxyphenyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 155221844 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-methoxy-5-(4-methoxyphenyl)-2,3-dihydro-1H-indene |
| SMILES | COc1ccc(-c2ccc3c(c2)CCC3OC)cc1 |
| InChI | InChI=1S/C17H18O2/c1-18-15-7-3-12(4-8-15)13-5-9-16-14(11-13)6-10-17(16)19-2/h3-5,7-9,11,17H,6,10H2,1-2H3 |
| InChIKey | MUKYDZLWUCAXDT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |