C46H46O8 — CID 163044374
(1S)-1,6,8-trimethoxy-9-(4-methoxyphenyl)-7-[(4R)-2,4,9-trimethoxy-3-(4-methoxyphenyl)-5,6-dihydro-4H-phenalen-1-yl]-2,3-dihydro-1H-phenalene (PubChem CID 163044374) has the molecular formula C46H46O8 and a molecular weight of 726.87 g/mol. Its IUPAC name is (1S)-1,6,8-trimethoxy-9-(4-methoxyphenyl)-7-[(4R)-2,4,9-trimethoxy-3-(4-methoxyphenyl)-5,6-dihydro-4H-phenalen-1-yl]-2,3-dihydro-1H-phenalene.
| Compound Name | (1S)-1,6,8-trimethoxy-9-(4-methoxyphenyl)-7-[(4R)-2,4,9-trimethoxy-3-(4-methoxyphenyl)-5,6-dihydro-4H-phenalen-1-yl]-2,3-dihydro-1H-phenalene |
|---|---|
| PubChem CID | 163044374 |
| Molecular Formula | C46H46O8 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | (1S)-1,6,8-trimethoxy-9-(4-methoxyphenyl)-7-[(4R)-2,4,9-trimethoxy-3-(4-methoxyphenyl)-5,6-dihydro-4H-phenalen-1-yl]-2,3-dihydro-1H-phenalene |
| SMILES | COc1ccc(-c2c(OC)c(-c3c(OC)c(-c4ccc(OC)cc4)c4c5c(ccc(OC)c35)CC[C@H]4OC)c3c(OC)ccc4c3c2[C@@H](OC)CC4)cc1 |
| InChI | InChI=1S/C46H46O8/c1-47-29-17-9-27(10-18-29)37-39-31(49-3)21-13-25-15-23-33(51-5)41(35(25)39)43(45(37)53-7)44-42-34(52-6)24-16-26-14-22-32(50-4)40(36(26)42)38(46(44)54-8)28-11-19-30(48-2)20-12-28/h9-12,15-20,23-24,31-32H,13-14,21-22H2,1-8H3/t31-,32+ |
| InChIKey | ZZOOPDZXZOMMBA-MEKGRNQZSA-N |
| XLogP | 10.31 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |