C20H18O4 — CID 74027046
4-(4-methoxyphenyl)-2,3-dihydro-1H-phenalene-1,2,3-triol (PubChem CID 74027046) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,3-dihydro-1H-phenalene-1,2,3-triol.
| Compound Name | 4-(4-methoxyphenyl)-2,3-dihydro-1H-phenalene-1,2,3-triol |
|---|---|
| PubChem CID | 74027046 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,3-dihydro-1H-phenalene-1,2,3-triol |
| SMILES | COc1ccc(-c2ccc3cccc4c3c2C(O)C(O)C4O)cc1 |
| InChI | InChI=1S/C20H18O4/c1-24-13-8-5-11(6-9-13)14-10-7-12-3-2-4-15-16(12)17(14)19(22)20(23)18(15)21/h2-10,18-23H,1H3 |
| InChIKey | UBACNSNNFBHJLG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |