C27H34N2O4 — CID 156739968
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] N-[6-[2-(2-methoxyethoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate (PubChem CID 156739968) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is [(3S)-1-azabicyclo[2.2.2]octan-3-yl] N-[6-[2-(2-methoxyethoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate.
| Compound Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] N-[6-[2-(2-methoxyethoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 156739968 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] N-[6-[2-(2-methoxyethoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
| SMILES | COCCOc1ccccc1-c1ccc2c(c1)CCCC2NC(=O)O[C@@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C27H34N2O4/c1-31-15-16-32-25-8-3-2-6-23(25)21-9-10-22-20(17-21)5-4-7-24(22)28-27(30)33-26-18-29-13-11-19(26)12-14-29/h2-3,6,8-10,17,19,24,26H,4-5,7,11-16,18H2,1H3,(H,28,30)/t24?,26-/m1/s1 |
| InChIKey | OSGAUZSGJYVOAY-JUERFOTFSA-N |
| XLogP | 4.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|