C17H14F3NO2 — CID 140712080
2-[(1R)-6-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 140712080) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-[(1R)-6-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 2-[(1R)-6-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 140712080 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[(1R)-6-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | NC(=O)c1ccccc1[C@@H]1CCc2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C17H14F3NO2/c18-17(19,20)23-11-7-5-10-6-8-13(15(10)9-11)12-3-1-2-4-14(12)16(21)22/h1-5,7,9,13H,6,8H2,(H2,21,22)/t13-/m0/s1 |
| InChIKey | DRRNKZOWCRVBEC-ZDUSSCGKSA-N |
| XLogP | 3.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |