C15H13F3N2O2 — CID 174355835
7-azabicyclo[4.2.0]octa-1,3,5-triene;3-(trifluoromethoxy)benzamide (PubChem CID 174355835) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is 7-azabicyclo[4.2.0]octa-1,3,5-triene;3-(trifluoromethoxy)benzamide.
| Compound Name | 7-azabicyclo[4.2.0]octa-1,3,5-triene;3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 174355835 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 7-azabicyclo[4.2.0]octa-1,3,5-triene;3-(trifluoromethoxy)benzamide |
| SMILES | NC(=O)c1cccc(OC(F)(F)F)c1.c1ccc2c(c1)CN2 |
| InChI | InChI=1S/C8H6F3NO2.C7H7N/c9-8(10,11)14-6-3-1-2-5(4-6)7(12)13;1-2-4-7-6(3-1)5-8-7/h1-4H,(H2,12,13);1-4,8H,5H2 |
| InChIKey | BAXPROFQRKSUCS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |