C17H18F3N3O2 — CID 142270751
1,2,3,4-tetrahydroisoquinolin-7-amine;3-(trifluoromethoxy)benzamide (PubChem CID 142270751) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinolin-7-amine;3-(trifluoromethoxy)benzamide.
| Compound Name | 1,2,3,4-tetrahydroisoquinolin-7-amine;3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 142270751 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinolin-7-amine;3-(trifluoromethoxy)benzamide |
| SMILES | NC(=O)c1cccc(OC(F)(F)F)c1.Nc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C9H12N2.C8H6F3NO2/c10-9-2-1-7-3-4-11-6-8(7)5-9;9-8(10,11)14-6-3-1-2-5(4-6)7(12)13/h1-2,5,11H,3-4,6,10H2;1-4H,(H2,12,13) |
| InChIKey | JPHZFRUXTZQOJD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|